| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:56 UTC |
|---|
| Update Date | 2025-03-25 00:46:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157848 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O4S |
|---|
| Molecular Mass | 260.0831 |
|---|
| SMILES | O=C(O)CCCC1SCC2C(O)NC(=O)NC12 |
|---|
| InChI Key | AEFVQWWCZGDAQT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkanolaminesazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdiazinanesheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsshort-chain hydroxy acids and derivativesthiolanes |
|---|
| Substituents | thiolanefatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidfatty acidpyrimidonecarboxylic acid derivativealiphatic heteropolycyclic compound1,3-diazinaneorganic oxideorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidalkanolaminecarbonic acid derivativeazacycledialkylthioethermonocarboxylic acid or derivativesorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
