| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:56 UTC |
|---|
| Update Date | 2025-03-25 00:46:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157852 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O6 |
|---|
| Molecular Mass | 292.0947 |
|---|
| SMILES | O=C(O)CCCC(OC(=O)C=Cc1ccccc1)C(=O)O |
|---|
| InChI Key | KWKRSNUOAMJFLS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acidsenoate estersfatty acid estershydrocarbon derivativesorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | enoate esterfatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidtricarboxylic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundalpha,beta-unsaturated carboxylic esterfatty acid estercinnamic acid or derivativesorganic oxideorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
