| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:57 UTC |
|---|
| Update Date | 2025-03-25 00:46:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157890 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6O7 |
|---|
| Molecular Mass | 214.0114 |
|---|
| SMILES | O=C(O)Oc1cc(O)cc(O)c1C(=O)O |
|---|
| InChI Key | RAGVVFDVKSAEQJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativescarbonic acid monoesterscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsresorcinolsvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidcarboxylic acid derivativeresorcinolorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidcarbonic acid derivative1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativescarbonic acid monoesterorganic oxygen compoundphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
