| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:57 UTC |
|---|
| Update Date | 2025-03-25 00:46:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157894 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O9P |
|---|
| Molecular Mass | 229.9828 |
|---|
| SMILES | O=C(O)OCC(O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | BZQJYAIEZRQRKS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonic acid monoesterscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic phosphoric acids and derivativessecondary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarbonic acid derivativeacyl monophosphatemonosaccharidecarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativescarbonic acid monoesterorganic oxygen compoundglyceric_acidsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|