| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:00 UTC |
|---|
| Update Date | 2025-03-25 00:46:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02157985 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11O6+ |
|---|
| Molecular Mass | 299.055 |
|---|
| SMILES | O=C(O)c1ccc(O)c(-c2ccc3c(O)cc(O)cc3[o+]2)c1 |
|---|
| InChI Key | FEQYKRHGUQSYKB-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids7-hydroxyflavonoidsanthocyanidinsbenzoic acidsbenzoyl derivativescarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxybenzoic acid derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietycarboxylic acid1-benzopyranbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundanthocyanidinorganic cationbenzoic acidorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoidbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidhydroxybenzoic acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compound7-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
