| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:00 UTC |
|---|
| Update Date | 2025-03-25 00:46:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158016 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O7S |
|---|
| Molecular Mass | 350.046 |
|---|
| SMILES | O=C(O)c1cccc(C2Oc3cc(S(=O)O)cc(O)c3CC2O)c1 |
|---|
| InChI Key | QIIQUOTUONLUDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-hydroxyflavonoidsalkyl aryl ethersbenzoic acidsbenzoyl derivativescarboxylic acidsflavan-3-olshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfur compoundsoxacyclic compoundssecondary alcoholssulfinic acids |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidethercarboxylic acid1-benzopyranflavansulfinic acid derivativebenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganosulfur compoundcarboxylic acid derivativesulfinic acidorganic oxidearomatic heteropolycyclic compoundchromanebenzoic acidflavan-3-olorganoheterocyclic compoundalcoholbenzopyran5-hydroxyflavonoidbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|