| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:01 UTC |
|---|
| Update Date | 2025-03-25 00:46:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158033 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO7 |
|---|
| Molecular Mass | 255.0379 |
|---|
| SMILES | O=C(O)c1cc(NC(C(=O)O)C(=O)O)ccc1O |
|---|
| InChI Key | MWYYSVCNXDRXRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compounds1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsamino acidsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminessecondary alkylarylaminestricarboxylic acids and derivativesvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidbenzoyl1-hydroxy-2-unsubstituted benzenoidtricarboxylic acid or derivativesalpha-amino acid or derivativessalicylic acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidsecondary aminesecondary aliphatic/aromatic aminearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenylalkylaminephenolhydrocarbon derivativeorganic nitrogen compound1,3-dicarbonyl compoundamineorganooxygen compound |
|---|