| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:01 UTC |
|---|
| Update Date | 2025-03-25 00:46:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158049 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H8O4 |
|---|
| Molecular Mass | 240.0423 |
|---|
| SMILES | O=C(O)c1cc(=O)oc2cc3ccccc3cc12 |
|---|
| InChI Key | OXPYOHQLGHDXCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyranones |
|---|
| Direct Parent | naphthopyranones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-carboxy-2-haloaromatic compoundscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyrancarboxylic acid1-benzopyranheteroaromatic compoundcarboxylic acid derivativecoumarinnaphthopyranonelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundorganooxygen compound |
|---|
