| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:02 UTC |
|---|
| Update Date | 2025-03-25 00:46:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158055 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O5 |
|---|
| Molecular Mass | 258.0528 |
|---|
| SMILES | O=C(O)c1ccc(C(=O)C=Cc2ccc(O)cc2)o1 |
|---|
| InChI Key | ZIELPDLZTHFNBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha,beta-unsaturated ketonesaryl ketonesbenzene and substituted derivativescarboxylic acidsfuroic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | furanmonocyclic benzene moietycarboxylic acidaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidalpha,beta-unsaturated ketonecarboxylic acid derivativeketoneorganic oxideorganoheterocyclic compoundfuroic acid or derivativesheteroaromatic compoundfuroic acidhydroxycinnamic acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
