| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:02 UTC |
|---|
| Update Date | 2025-03-25 00:46:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158056 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O7 |
|---|
| Molecular Mass | 330.074 |
|---|
| SMILES | O=C(O)c1ccc(C(=O)OC(Cc2ccc(O)cc2)C(=O)O)cc1 |
|---|
| InChI Key | VSPYMLVJJDJEAJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-phthalate esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoic acid estersbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidshydrocarbon derivativesorganic oxidesp-phthalic acid and derivativesphenylpropanoic acidstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acid3-phenylpropanoic-acidbenzoyl1-hydroxy-2-unsubstituted benzenoidtricarboxylic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativepara-phthalic acid esterbenzoic acidorganooxygen compoundpara_phthalic_acid |
|---|
