| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:02 UTC |
|---|
| Update Date | 2025-03-25 00:46:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158073 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16O8 |
|---|
| Molecular Mass | 288.0845 |
|---|
| SMILES | C=CC(O)=CC(=O)OC1C(O)CC(O)(C(=O)O)CC1O |
|---|
| InChI Key | KQISPHVYIRAWEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclohexanolsdicarboxylic acids and derivativesenoate estersfatty acid estershydrocarbon derivativesorganic oxidestertiary alcoholsvinylogous acids |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativealpha,beta-unsaturated carboxylic esterorganic oxideenoate estercyclohexanolhydroxy acidfatty acid estervinylogous acidtertiary alcoholcarboxylic acid estersecondary alcoholaliphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativequinic acid |
|---|
