| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:41:04 UTC | 
|---|
| Update Date | 2025-03-25 00:46:55 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02158134 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C11H9NO4 | 
|---|
| Molecular Mass | 219.0532 | 
|---|
| SMILES | O=C(O)CNC(=O)C#Cc1ccc(O)cc1 | 
|---|
| InChI Key | VFZHHHOSYZMAIA-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organic acids and derivatives | 
|---|
| Class | carboxylic acids and derivatives | 
|---|
| Subclass  | amino acids, peptides, and analogues | 
|---|
| Direct Parent  | acyl glycines | 
|---|
| Geometric Descriptor  | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents  | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides | 
|---|
| Substituents  | monocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidcarboxamide groupn-acylglycinearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound | 
|---|