| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:06 UTC |
|---|
| Update Date | 2025-03-25 00:46:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158215 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22O13 |
|---|
| Molecular Mass | 386.106 |
|---|
| SMILES | O=C(O)COC1(OC2OC(CO)C(O)C(O)C2O)OC(CO)C(O)C1O |
|---|
| InChI Key | HZOIYWLKIWAWLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | orthocarboxylic acid derivatives |
|---|
| Subclass | carboxylic acid orthoesters |
|---|
| Direct Parent | carboxylic acid orthoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesortho estersoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidortho estertetrahydrofuranmonosaccharidecarboxylic acid orthoestercarboxylic acid derivativeoxacyclesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundacetalaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|