| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:41:06 UTC | 
|---|
| Update Date | 2025-03-25 00:46:55 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02158241 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C12H14O6S | 
|---|
| Molecular Mass | 286.0511 | 
|---|
| SMILES | O=C(O)CSCC(=O)C(O)Cc1ccc(O)c(O)c1 | 
|---|
| InChI Key | NRRZGUNJGPRAFB-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | benzenoids | 
|---|
| Class | phenols | 
|---|
| Subclass  | 1-hydroxy-2-unsubstituted benzenoids | 
|---|
| Direct Parent  | 1-hydroxy-2-unsubstituted benzenoids | 
|---|
| Geometric Descriptor  | aromatic homomonocyclic compounds | 
|---|
| Alternative Parents  | 1-hydroxy-4-unsubstituted benzenoidsacyloinsalpha-hydroxy ketonesbenzene and substituted derivativescarboxylic acidsdialkylthioethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholssulfenyl compounds | 
|---|
| Substituents  | monocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidmonosaccharideorganosulfur compoundalpha-hydroxy ketonecarboxylic acid derivativeketonesaccharideorganic oxidealcoholsulfenyl compounddialkylthioether1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundthioetheracyloinsecondary alcoholhydrocarbon derivativeorganooxygen compound | 
|---|