| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:07 UTC |
|---|
| Update Date | 2025-03-25 00:46:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158249 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13ClO5 |
|---|
| Molecular Mass | 284.0452 |
|---|
| SMILES | O=C(O)COc1ccc(CC2CCC(=O)O2)cc1Cl |
|---|
| InChI Key | GEMXLCZESQBXPD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | chlorophenoxyacetates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescarbonyl compoundscarboxylic acid esterscarboxylic acidschlorobenzenesdicarboxylic acids and derivativesgamma butyrolactoneshydrocarbon derivativesorganic oxidesorganochloridesoxacyclic compoundsphenol ethersphenoxy compoundstetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundlactoneorganic oxideorganoheterocyclic compoundaryl chloridechlorobenzenetetrahydrofurangamma butyrolactonearyl halideoxacycleorganic oxygen compoundchlorophenoxyacetatecarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativehalobenzenephenoxy compoundorganooxygen compound |
|---|