| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:07 UTC |
|---|
| Update Date | 2025-03-25 00:46:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158253 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17O12P |
|---|
| Molecular Mass | 348.0458 |
|---|
| SMILES | O=C(O)COP(=O)(O)OCC1OC(O)(CO)C(O)C(O)C1O |
|---|
| InChI Key | AGRAYBKDPSVZJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl phosphateshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycledialkyl phosphateorganic oxidemonocarboxylic acid or derivativesphosphoric acid esteraliphatic heteromonocyclic compoundsecondary alcoholhexose phosphatehemiacetalhydrocarbon derivativeoxaneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound |
|---|
