| Record Information | 
|---|
| HMDB Status | Not Available | 
|---|
| Creation Date | 2024-02-21 14:41:11 UTC | 
|---|
| Update Date | 2025-03-25 00:46:56 UTC | 
|---|
| HMDB ID | Not Available | 
|---|
| Metabolite Identification | 
|---|
| DeepMet ID | DMID02158403 | 
|---|
| Frequency | 0.5 | 
|---|
| Structure |  | 
|---|
| Chemical Formula | C16H15NO3 | 
|---|
| Molecular Mass | 269.1052 | 
|---|
| SMILES | OCC(c1ccc(O)cc1)c1c[nH]c2ccc(O)cc12 | 
|---|
| InChI Key | VGPRLQCTDWSGJI-UHFFFAOYSA-N | 
|---|
| Chemical Taxonomy | 
|---|
| Kingdom | organic compounds | 
|---|
| Superclass | organoheterocyclic compounds | 
|---|
| Class | indoles and derivatives | 
|---|
| Subclass  | indoles | 
|---|
| Direct Parent  | indoles | 
|---|
| Geometric Descriptor  | aromatic heteropolycyclic compounds | 
|---|
| Alternative Parents  | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrroles | 
|---|
| Substituents  | alcoholmonocyclic benzene moietyazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundprimary alcoholorganooxygen compound | 
|---|