| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:17 UTC |
|---|
| Update Date | 2025-03-25 00:46:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158609 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H10O6 |
|---|
| Molecular Mass | 310.0477 |
|---|
| SMILES | O=c1oc2c3ccc(O)cc3cc(O)c2c2ccc(O)c(O)c12 |
|---|
| InChI Key | LIGJMMDQUHXEBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyrans |
|---|
| Direct Parent | naphthopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-benzopyranscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | benzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidisocoumarincoumarinlactoneoxacyclevinylogous acidnaphthopyranorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivativebenzenoid2-naphtholorganooxygen compound |
|---|
