| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:18 UTC |
|---|
| Update Date | 2025-03-25 00:46:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158663 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O6 |
|---|
| Molecular Mass | 342.1103 |
|---|
| SMILES | OC1OC(Oc2cccc3ccc4ccccc4c23)C(O)C(O)C1O |
|---|
| InChI Key | RHJWUPGUIMXFDO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalshemiacetalshydrocarbon derivativesmonosaccharidesnaphthalenesoxacyclic compoundsoxanesphenol etherssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthrenemonosaccharideoxacyclesaccharidenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
