| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:23 UTC |
|---|
| Update Date | 2025-03-25 00:47:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158828 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H16O3 |
|---|
| Molecular Mass | 304.1099 |
|---|
| SMILES | Oc1ccc(C2Cc3ccc(O)cc3-c3cc(O)ccc32)cc1 |
|---|
| InChI Key | ZYXWAQJRANPHSO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesnaphthols and derivativesorganooxygen compoundsphenanthrenes and derivatives |
|---|
| Substituents | monocyclic benzene moietyphenanthrene1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundorganic oxygen compoundphenylnaphthalenephenolhydrocarbon derivative2-naphtholorganooxygen compound |
|---|
