| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:23 UTC |
|---|
| Update Date | 2025-03-25 00:47:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158847 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11N5O2 |
|---|
| Molecular Mass | 269.0913 |
|---|
| SMILES | Oc1ccc(NCc2cnc3ncnc(O)c3n2)cc1 |
|---|
| InChI Key | PZOYHQCVDJPUGK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesorganooxygen compoundsorganopnictogen compoundsphenylalkylaminespyrazinessecondary alkylarylamines |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidhydroxypyrimidinesecondary aminepteridinesecondary aliphatic/aromatic aminepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundphenylalkylaminephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
