| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:23 UTC |
|---|
| Update Date | 2025-03-25 00:47:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158851 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O4 |
|---|
| Molecular Mass | 204.0423 |
|---|
| SMILES | Oc1ccc(O)c2c3c(ccc12)OCO3 |
|---|
| InChI Key | PYKQRCQGOZJXGJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzodioxoleshydrocarbon derivativeshydroquinonesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | 1-hydroxy-2-unsubstituted benzenoidhydroquinoneoxacycleorganic oxygen compoundacetalaromatic heteropolycyclic compoundhydrocarbon derivative1-naphtholorganoheterocyclic compoundorganooxygen compoundbenzodioxole |
|---|
