| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:24 UTC |
|---|
| Update Date | 2025-03-25 00:47:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02158878 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N3 |
|---|
| Molecular Mass | 201.1266 |
|---|
| SMILES | c1cc2c(C3CCNCC3)c[nH]c2cn1 |
|---|
| InChI Key | BESGNGHOVVYHFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | halopyridines |
|---|
| Direct Parent | polyhalopyridines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundspiperidinespyridines and derivativespyrroles |
|---|
| Substituents | secondary aliphatic amineazacyclepolyhalopyridineheteroaromatic compoundsecondary aminearomatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpiperidineamine |
|---|
