| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:28 UTC |
|---|
| Update Date | 2025-03-25 00:47:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159012 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H27Cl2N3O5 |
|---|
| Molecular Mass | 507.1328 |
|---|
| SMILES | OCCN(CCO)c1ccc(OCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
|---|
| InChI Key | WHSZLNMSLFEBEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenol ethers |
|---|
| Subclass | aminophenyl ethers |
|---|
| Direct Parent | aminophenyl ethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcohols1,3-dioxolanesalcohols and polyolsalkyl aryl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundsdialkylarylaminesdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesimidazolesketalsn-substituted imidazolesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietymeta-dioxolaneetheraromatic heteromonocyclic compoundorganochloridealkyl aryl etherorganohalogen compound1,3-dichlorobenzeneacetalimidazoleketaltertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineorganoheterocyclic compoundalkanolamineazolen-substituted imidazolearyl chloridechlorobenzenealcoholazacycle1,2-aminoalcoholaniline or substituted anilinesheteroaromatic compoundaryl halideoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundamineorganooxygen compound |
|---|
