| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:33 UTC |
|---|
| Update Date | 2025-03-25 00:47:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159232 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N2O6PS |
|---|
| Molecular Mass | 296.0232 |
|---|
| SMILES | O=P(O)(S)OCC1OC(n2ccnc2)C(O)C1O |
|---|
| InChI Key | DYNOFIZCVVGWDY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | imidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | imidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | imidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholimidazole ribonucleosidearomatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundazole1,2-dioln-substituted imidazole |
|---|