| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:34 UTC |
|---|
| Update Date | 2025-03-25 00:47:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159248 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N4O5P |
|---|
| Molecular Mass | 298.0467 |
|---|
| SMILES | O=P1(O)OC2CC(n3cnc4cncnc43)C(O)C2O1 |
|---|
| InChI Key | RFTTXNDMUYUCAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | alcoholazacycleheteroaromatic compound1,3_dioxaphospholanecyclic alcoholpyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundazolen-substituted imidazole |
|---|
