| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:34 UTC |
|---|
| Update Date | 2025-03-25 00:47:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159254 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O11PS |
|---|
| Molecular Mass | 323.9916 |
|---|
| SMILES | O=P(O)(O)OS(=O)(=O)C1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | FPPFXBLWSPBUGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesorganosulfonic acids and derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssulfonyls |
|---|
| Substituents | alcoholorganosulfonic acid or derivativesmonosaccharideorganosulfur compoundoxacycleorganic oxidesulfonylorganic sulfonic acid or derivativesaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganic phosphoric acid derivativeorganoheterocyclic compound |
|---|
