| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:35 UTC |
|---|
| Update Date | 2025-03-25 00:47:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159274 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O3 |
|---|
| Molecular Mass | 250.1569 |
|---|
| SMILES | C=C(OCC(C)(O)CCC(C)O)c1ccccc1 |
|---|
| InChI Key | YXRHUDFXCXHREM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholaromatic homomonocyclic compoundmonocyclic benzene moietytertiary alcoholorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|