| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:38 UTC |
|---|
| Update Date | 2025-03-25 00:47:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159389 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4ClNO3S2 |
|---|
| Molecular Mass | 248.9321 |
|---|
| SMILES | O=S(=O)(N=C=S)Oc1ccc(Cl)cc1 |
|---|
| InChI Key | AUJCNATZHGSHLT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxy compounds |
|---|
| Direct Parent | phenoxy compounds |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chlorideschlorobenzeneshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfur compounds |
|---|
| Substituents | aryl chloridechlorobenzeneorganic sulfuric acid or derivativesorganochlorideorganosulfur compoundorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compound |
|---|
