| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:38 UTC |
|---|
| Update Date | 2025-03-25 00:47:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159402 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H2F15NO5S2 |
|---|
| Molecular Mass | 528.9135 |
|---|
| SMILES | O=S(=O)(O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | ZJBUWHBYFOIRQS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganofluoridesorganosulfonic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acid or derivativesorganic sulfuric acid or derivativesaminosulfonyl compoundalkyl fluorideorganofluorideorganosulfur compoundorganohalogen compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesalkyl halidehydrocarbon derivativeorganic nitrogen compound |
|---|
