| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:42 UTC |
|---|
| Update Date | 2025-03-25 00:47:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159527 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18NO9P |
|---|
| Molecular Mass | 375.0719 |
|---|
| SMILES | O=Cc1cn(CC(O)C(O)C(O)COP(=O)(O)O)c2ccc(O)cc12 |
|---|
| InChI Key | NMJVNWIXKOQNQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl-aldehydesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesmonoalkyl phosphatesn-alkylindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssubstituted pyrrolesvinylogous amides |
|---|
| Substituents | n-alkylindoleindole1-hydroxy-2-unsubstituted benzenoidsubstituted pyrroleorganic oxidearyl-aldehydearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundindolecarboxylic acid derivativealcoholvinylogous amideazacycleheteroaromatic compoundaldehydeorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|