| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:42 UTC |
|---|
| Update Date | 2025-03-25 00:47:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159532 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12NO10P |
|---|
| Molecular Mass | 289.0199 |
|---|
| SMILES | O=NOP(=O)(O)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | ZUFKVKIRQFNVIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonosaccharidesorganic o-nitroso compoundsorganic nitritesorganic nitrogen compoundsorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholorganic nitroso compoundmonosaccharideorganic nitriteoxacyclesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compoundorganic o-nitroso compound |
|---|
