| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:43 UTC |
|---|
| Update Date | 2025-03-25 00:47:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159572 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7Cl2O4P |
|---|
| Molecular Mass | 255.9459 |
|---|
| SMILES | O=P(O)(O)C(Cl)(Cl)c1ccc(O)cc1 |
|---|
| InChI Key | WAZIJTRJLKXNIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chloridesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganochloridesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietyalkyl chlorideorganochloride1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
