| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:43 UTC |
|---|
| Update Date | 2025-03-25 00:47:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159574 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H5Cl3O6P2 |
|---|
| Molecular Mass | 291.8627 |
|---|
| SMILES | O=P(O)(Cl)OCC(Cl)(Cl)P(=O)(O)O |
|---|
| InChI Key | IEHSTLJQUDVVFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphate esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganochloridesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundalkyl chlorideorganochlorideorganohalogen compoundorganic oxideorganic oxygen compoundphosphoric acid esterorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|