| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:43 UTC |
|---|
| Update Date | 2025-03-25 00:47:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159587 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9N4O5P |
|---|
| Molecular Mass | 260.0311 |
|---|
| SMILES | O=P(O)(O)CCn1cnc2c(O)nc(O)nc21 |
|---|
| InChI Key | SPNQMFDSMVKHMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganonitrogen compoundsorganooxygen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | azacycleheteroaromatic compoundhydroxypyrimidinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativepurineorganic nitrogen compoundorganophosphonic acid derivativeorganooxygen compoundazolen-substituted imidazole |
|---|
