| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:43 UTC |
|---|
| Update Date | 2025-03-25 00:47:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159590 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H16O12P2 |
|---|
| Molecular Mass | 354.0117 |
|---|
| SMILES | O=P(O)(O)C(O)P(=O)(O)OCC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | NXXWGYCGUNFDEM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | bisphosphonates |
|---|
| Direct Parent | bisphosphonates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphosphonic acid esterssecondary alcohols |
|---|
| Substituents | alcoholbisphosphonatemonosaccharidephosphonic acid esteroxacyclesaccharideorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundhemiacetalorganophosphorus compoundhydrocarbon derivativeoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
