| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:46 UTC |
|---|
| Update Date | 2025-03-25 00:47:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159703 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O5 |
|---|
| Molecular Mass | 222.0528 |
|---|
| SMILES | O=c1cc(C(O)CO)c2ccc(O)cc2o1 |
|---|
| InChI Key | IMZSPAWUOPKYDY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | hydroxycoumarins |
|---|
| Direct Parent | 7-hydroxycoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsaromatic alcoholsbenzenoidscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsprimary alcoholspyranones and derivativessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholbenzopyran7-hydroxycoumarin1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonesecondary alcoholhydrocarbon derivativebenzenoidprimary alcoholorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|