| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:47 UTC |
|---|
| Update Date | 2025-03-25 00:47:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159714 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H14O7 |
|---|
| Molecular Mass | 414.074 |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)c3oc(-c4ccc(O)cc4)cc(=O)c3c12 |
|---|
| InChI Key | KMJRMVIKWHFFHD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | pyranoisoflavonoids |
|---|
| Direct Parent | pyranoisoflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoids8-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesisoflavoneslinear diarylheptanoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganic oxidechromonearomatic heteropolycyclic compoundpyranoneflavonoidorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundpyranoisoflavonoidoxacycleorganic oxygen compoundpyran4'-hydroxyflavonoidphenollinear 1,7-diphenylheptane skeletonhydrocarbon derivativebenzenoidorganooxygen compound |
|---|