| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:48 UTC |
|---|
| Update Date | 2025-03-25 00:47:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159776 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N2O8P |
|---|
| Molecular Mass | 318.0253 |
|---|
| SMILES | O=c1ccn(C2OC3COC3C3OP(=O)(O)OC32)c(=O)[nH]1 |
|---|
| InChI Key | CNEURZXLVXXPDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersdioxaphospholanesheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesoxetanesvinylogous amides |
|---|
| Substituents | etherlactammonosaccharidepyrimidonedialkyl ethersaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanevinylogous amidecarbonic acid derivativeazacycleheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundoxetanehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
