| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:48 UTC |
|---|
| Update Date | 2025-03-25 00:47:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159779 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N2O7P |
|---|
| Molecular Mass | 290.0304 |
|---|
| SMILES | O=c1ccn(C2OP(=O)(O)OCC3OCC32)c(=O)[nH]1 |
|---|
| InChI Key | BPGYWXYJGYAMOV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesvinylogous amides |
|---|
| Substituents | vinylogous amideethercarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonedialkyl etheroxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundoxetaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
