| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:49 UTC |
|---|
| Update Date | 2025-03-25 00:47:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159787 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8N4O2 |
|---|
| Molecular Mass | 228.0647 |
|---|
| SMILES | O=c1nc[nH]c2[nH]c(-c3ccc(O)cc3)nc12 |
|---|
| InChI Key | HZMYSDCRKFQABE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | imidazoles |
|---|
| Direct Parent | phenylimidazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | monocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidpyrimidoneimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundvinylogous amideazacycleheteroaromatic compoundorganic oxygen compound2-phenylimidazolehypoxanthinephenolhydrocarbon derivativebenzenoidpurineorganic nitrogen compoundorganooxygen compound |
|---|