| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:49 UTC |
|---|
| Update Date | 2025-03-25 00:47:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159789 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11IN2O5 |
|---|
| Molecular Mass | 353.9713 |
|---|
| SMILES | O=c1ncc(I)cn1C1OC(CO)C(O)C1O |
|---|
| InChI Key | OJGPEIGABBUQOM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl iodidesazacyclic compoundshalopyrimidinesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundmonosaccharidepyrimidoneorganohalogen compoundpyrimidineorganoiodidesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosideprimary alcoholorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundhalopyrimidinearyl halideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativearyl iodideorganic nitrogen compoundorganooxygen compound |
|---|
