| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:51 UTC |
|---|
| Update Date | 2025-03-25 00:47:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159868 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C32H36N2O6S |
|---|
| Molecular Mass | 576.2294 |
|---|
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N(O)CC(Cc1ccccc1)C(Cc1ccccc1)NC(O)OC1CCOC1 |
|---|
| InChI Key | NQIPFKMDEYKVOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | Not Available |
|---|
| Subclass | lignans, neolignans and related compounds |
|---|
| Direct Parent | lignans, neolignans and related compounds |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-naphthalene sulfonamides2-naphthalene sulfonic acids and derivativesalkanolaminesaminosulfonyl compoundsamphetamines and derivativesdialkyl ethersdialkylamineshydrocarbon derivativesn-organohydroxylaminesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesorthocarboxylic acid derivativesoxacyclic compoundsphenylbutylaminestetrahydrofurans |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyethernorlignan skeletonorganosulfur compounddialkyl ether2-naphthalene sulfonamideorganic oxidephenylbutylaminearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorthocarboxylic acid derivativeorganoheterocyclic compoundamphetamine or derivativesalkanolaminenaphthalene sulfonic acid or derivativessecondary aliphatic amineaminosulfonyl compoundtetrahydrofurannaphthalene sulfonamidesecondary aminen-organohydroxylamine2-naphthalene sulfonic acid or derivativesoxacyclesulfonylnaphthaleneorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
