| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:51 UTC |
|---|
| Update Date | 2025-03-25 00:47:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159871 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N4O7S |
|---|
| Molecular Mass | 332.0427 |
|---|
| SMILES | O=S(=O)(O)c1cnc2ncn(C3OC(CO)C(O)C3O)c2n1 |
|---|
| InChI Key | MVSQLSWYBLKDHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | arylsulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidazopyrazinesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidsoxacyclic compoundsprimary alcoholspyrazinessecondary alcoholssulfonylstetrahydrofurans |
|---|
| Substituents | imidazopyrazineorganosulfonic acidmonosaccharideorganosulfur compoundsaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclesulfonylorganic oxygen compoundarylsulfonic acid or derivativespyrazinesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
