| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:51 UTC |
|---|
| Update Date | 2025-03-25 00:47:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159886 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H6Cl2O3S |
|---|
| Molecular Mass | 275.9415 |
|---|
| SMILES | O=S(=O)(O)c1cc2cccc(Cl)c2cc1Cl |
|---|
| InChI Key | WTLILMWHFOUGQE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 2-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compounds2-naphthalene sulfonatesaryl chloridesarylsulfonic acids and derivativeschloronaphthaleneshydrocarbon derivativesorganic oxidesorganochloridesorganosulfonic acidssulfonyls |
|---|
| Substituents | aryl chlorideorganosulfonic acid or derivatives1-sulfo,2-unsubstituted aromatic compoundorganochlorideorganosulfonic acidchloronaphthalenearomatic homopolycyclic compoundorganosulfur compoundorganohalogen compoundaryl halide2-naphthalene sulfonic acid or derivativesorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonatehydrocarbon derivative2-naphthalene sulfonate |
|---|
