| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:53 UTC |
|---|
| Update Date | 2025-03-25 00:47:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159946 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H6F13NO6S2 |
|---|
| Molecular Mass | 570.9429 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
|---|
| InChI Key | BAGFVKMMRQAOBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundshydrocarbon derivativesorganic oxidesorganic sulfonamidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesphenoxy compoundssulfanilidessulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietysulfuric acid monoesterorganosulfur compoundorganohalogen compoundorganosulfonic acid amidephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halideaminosulfonyl compoundalkyl fluorideorganofluoridearomatic homomonocyclic compoundsulfanilidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganic sulfonic acid amideorganooxygen compound |
|---|