| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:54 UTC |
|---|
| Update Date | 2025-03-25 00:47:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159984 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H4N2O6S |
|---|
| Molecular Mass | 231.979 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc(O)c2nonc12 |
|---|
| InChI Key | RHANOEPSYJLKJZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidsbenzoxadiazolesfurazansheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidorganic oxidebenzoxadiazoleorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundoxadiazoleorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoidorganic nitrogen compoundsulfuric acid esterfurazanorganoheterocyclic compoundorganooxygen compoundazole |
|---|
