| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:54 UTC |
|---|
| Update Date | 2025-03-25 00:47:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159991 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6INO4S |
|---|
| Molecular Mass | 350.9062 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc2ccc(I)cc2n1 |
|---|
| InChI Key | GRPDOUJPFOXYPY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | quinolones and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl iodidesarylsulfatesazacyclic compoundsbenzenoidshaloquinolinesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganoiodidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterpolyhalopyridineorganohalogen compoundorganoiodidehaloquinolineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundarylsulfate2-halopyridinequinoloneorganic sulfuric acid or derivativesazacycleheteroaromatic compoundhydroxypyridinearyl halidepyridineorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidaryl iodideorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
