| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:55 UTC |
|---|
| Update Date | 2025-03-25 00:47:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02159997 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H9NO6 |
|---|
| Molecular Mass | 311.043 |
|---|
| SMILES | O=c1[nH]c2c(=O)oc3cc(O)ccc3c2c2cc(O)c(O)cc12 |
|---|
| InChI Key | DDFOJUOSOUOXLH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesisoquinolones and derivativeslactamslactonesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinespyranones and derivativespyridinones |
|---|
| Substituents | lactam1-benzopyranpolyhalopyridine1-hydroxy-2-unsubstituted benzenoidlactoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundisoquinolone2-halopyridineorganoheterocyclic compoundbenzopyranazacycleheteroaromatic compoundhydroxypyridinecoumarinoxacyclepyridineorganic oxygen compoundpyranisoquinolinehydrocarbon derivativebenzenoidorganic nitrogen compoundpyridinoneorganooxygen compound |
|---|
