| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:56 UTC |
|---|
| Update Date | 2025-03-25 00:47:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160055 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9NO4 |
|---|
| Molecular Mass | 183.0532 |
|---|
| SMILES | O=[N+]([O-])OCCc1ccc(O)cc1 |
|---|
| InChI Key | YNWGVFDJFWFSGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl nitratesbenzene and substituted derivativeshydrocarbon derivativesnitrate estersorganic nitro compoundsorganic nitrogen compoundsorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietyorganic nitric acid or derivativesorganic nitratenitrate esterallyl-type 1,3-dipolar organic compound1-hydroxy-2-unsubstituted benzenoidorganic 1,3-dipolar compoundorganic nitro compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundalkyl nitratehydrocarbon derivativetyrosol derivativeorganic nitrogen compoundorganooxygen compoundorganic hyponitrite |
|---|